From a3b21b8f4b8e8ae2af37fe580a8efe2e5726f8ac Mon Sep 17 00:00:00 2001 From: vitalets <noginsk@rambler.ru> Date: Thu, 10 Jan 2013 22:13:28 +0400 Subject: [PATCH] combodate ready --- src/containers/editable-popover.js | 15 +- src/inputs/combodate/combodate.js | 184 ++++++++++++ src/inputs/combodate/lib/combodate.js | 398 +++++++++++++++++++++++++ src/inputs/combodate/lib/moment.min.js | 6 + test/loader.js | 5 +- test/main.js | 3 +- test/unit/combodate.js | 107 +++++++ 7 files changed, 715 insertions(+), 3 deletions(-) create mode 100644 src/inputs/combodate/combodate.js create mode 100644 src/inputs/combodate/lib/combodate.js create mode 100644 src/inputs/combodate/lib/moment.min.js create mode 100644 test/unit/combodate.js diff --git a/src/containers/editable-popover.js b/src/containers/editable-popover.js index ab540f2..027043e 100644 --- a/src/containers/editable-popover.js +++ b/src/containers/editable-popover.js @@ -15,9 +15,22 @@ $.extend(this.containerOptions, { trigger: 'manual', selector: false, - content: ' ' + content: ' ', + template: $.fn.popover.defaults.template }); + + //as template property is used in inputs, hide it from popover + var t; + if(this.$element.data('template')) { + t = this.$element.data('template'); + this.$element.removeData('template'); + } + this.call(this.containerOptions); + + if(t) { + this.$element.data('template', t); + } }, setContainerOption: function(key, value) { diff --git a/src/inputs/combodate/combodate.js b/src/inputs/combodate/combodate.js new file mode 100644 index 0000000..6f25eb1 --- /dev/null +++ b/src/inputs/combodate/combodate.js @@ -0,0 +1,184 @@ +/** +Combodate input - dropdown date and time picker. +Based on [combodate](http://vitalets.github.com/combodate) plugin. +To use it you should manually include [momentjs](http://momentjs.com). +Allows to enter: + +* only date +* only time +* datetime + +Please note, that format is taken from momentjs and not compatible with bootstrap-datepicker / jquery UI datepicker. +Internally value stored as Moment js object + +@class combodate +@extends abstractinput +@final +@example +<a href="#" id="dob" data-type="combodate" data-pk="1" data-url="/post" data-value="1984-05-15" data-original-title="Select date"></a> +<script> +$(function(){ + $('#dob').editable({ + format: 'YYYY-MM-DD', + viewformat: 'YYYY-MM-DD', + template: 'D / MMMM / YYYY', + combodate: { + minYear: 2000, + maxYear: 2015, + minuteStep: 1 + } + } + }); +}); +</script> +**/ +(function ($) { + + var Constructor = function (options) { + this.init('combodate', options, Constructor.defaults); + + //by default viewformat equals to format + if(!this.options.viewformat) { + this.options.viewformat = this.options.format; + } + + //overriding combodate config (as by default jQuery extend() is not recursive) + this.options.combodate = $.extend({}, Constructor.defaults.combodate, options.combodate, { + format: this.options.format, + template: this.options.template + }); + }; + + $.fn.editableutils.inherit(Constructor, $.fn.editabletypes.abstractinput); + + $.extend(Constructor.prototype, { + render: function () { + this.$input.combodate(this.options.combodate); + + //"clear" link + /* + if(this.options.clear) { + this.$clear = $('<a href="#"></a>').html(this.options.clear).click($.proxy(function(e){ + e.preventDefault(); + e.stopPropagation(); + this.clear(); + }, this)); + + this.$tpl.parent().append($('<div class="editable-clear">').append(this.$clear)); + } + */ + }, + + value2html: function(value, element) { + var text = value ? value.format(this.options.viewformat) : ''; + $(element).text(text); + }, + + html2value: function(html) { + return html ? moment(html, this.options.viewformat) : null; + }, + + value2str: function(value) { + return value ? value.format(this.options.format) : ''; + }, + + str2value: function(str) { + return str ? moment(str, this.options.format) : null; + }, + + value2submit: function(value) { + return this.value2str(value); + }, + + value2input: function(value) { + this.$input.combodate('setValue', value); + }, + + input2value: function() { + return this.$input.combodate('getValue', null); + }, + + activate: function() { + this.$input.siblings('.combodate').find('select').eq(0).focus(); + }, + + /* + clear: function() { + this.$input.data('datepicker').date = null; + this.$input.find('.active').removeClass('active'); + }, + */ + + autosubmit: function() { + + } + + }); + + Constructor.defaults = $.extend({}, $.fn.editabletypes.abstractinput.defaults, { + /** + @property tpl + @default <input type="text"> + **/ + tpl:'<input type="text">', + /** + @property inputclass + @default null + **/ + inputclass: null, + /** + Format used for sending value to server. Also applied when converting date from <code>data-value</code> attribute.<br> + See list of tokens in [momentjs docs](http://momentjs.com/docs/#/parsing/string-format) + + @property format + @type string + @default YYYY-MM-DD + **/ + format:'YYYY-MM-DD', + /** + Format used for displaying date. Also applied when converting date from element's text on init. + If not specified equals to `format`. + + @property viewformat + @type string + @default null + **/ + viewformat: null, + /** + Template used for displaying dropdowns. + + @property template + @type string + @default D / MMM / YYYY + **/ + template: 'D / MMM / YYYY', + /** + Configuration of combodate. + Full list of options: http://vitalets.github.com/combodate/#docs + + @property datepicker + @type object + @default { + weekStart: 0, + startView: 0, + autoclose: false + } + **/ + combodate: { + }, + + /* + (not implemented yet) + Text shown as clear date button. + If <code>false</code> clear button will not be rendered. + + @property clear + @type boolean|string + @default 'x clear' + */ + //clear: '× clear' + }); + + $.fn.editabletypes.combodate = Constructor; + +}(window.jQuery)); diff --git a/src/inputs/combodate/lib/combodate.js b/src/inputs/combodate/lib/combodate.js new file mode 100644 index 0000000..e27adff --- /dev/null +++ b/src/inputs/combodate/lib/combodate.js @@ -0,0 +1,398 @@ +/** +* Combodate - 1.0.0 +* Dropdown date and time picker. +* Converts text input into dropdowns to pick day, month, year, hour, minute and second. +* Uses momentjs as datetime library http://momentjs.com. +* For i18n include corresponding file from https://github.com/timrwood/moment/tree/master/lang +* +* Author: Vitaliy Potapov +* Project page: http://github.com/vitalets/combodate +* Copyright (c) 2012 Vitaliy Potapov. Released under MIT License. +**/ +(function ($) { + + var Combodate = function (element, options) { + this.$element = $(element); + if(!this.$element.is('input')) { + $.error('Combodate should be applied to INPUT element'); + return; + } + this.options = $.extend({}, $.fn.combodate.defaults, options, this.$element.data()); + this.init(); + }; + + Combodate.prototype = { + constructor: Combodate, + init: function () { + this.map = { + //key regexp moment.method + day: ['D', 'date'], + month: ['M', 'month'], + year: ['Y', 'year'], + hour: ['[Hh]', 'hours'], + minute: ['m', 'minutes'], + second: ['s', 'seconds'], + ampm: ['[Aa]', ''] + }; + + this.$widget = $('<span class="combodate"></span>').html(this.getTemplate()); + + this.initCombos(); + + //update original input on change + this.$widget.on('change', 'select', $.proxy(function(){ + this.$element.val(this.getValue()); + }, this)); + + this.$widget.find('select').css('width', 'auto'); + + //hide original input and insert widget + this.$element.hide().after(this.$widget); + + //set initial value + this.setValue(this.$element.val() || this.options.value); + }, + + /* + Replace tokens in template with <select> elements + */ + getTemplate: function() { + var tpl = this.options.template; + + //first pass + $.each(this.map, function(k, v) { + var v = v[0], + r = new RegExp(v+'+'), + token = v.length > 1 ? v.substring(1, 2) : v; + + tpl = tpl.replace(r, '{'+token+'}'); + }); + + //replace spaces with + tpl = tpl.replace(/ /g, ' '); + + //second pass + $.each(this.map, function(k, v) { + var v = v[0], + token = v.length > 1 ? v.substring(1, 2) : v; + + tpl = tpl.replace('{'+token+'}', '<select class="'+k+'"></select>'); + }); + + return tpl; + }, + + /* + Initialize combos that presents in template + */ + initCombos: function() { + var that = this; + $.each(this.map, function(k, v) { + var $c = that.$widget.find('.'+k), f, items; + if($c.length) { + that['$'+k] = $c; //set properties like this.$day, this.$month etc. + f = 'fill' + k.charAt(0).toUpperCase() + k.slice(1); //define method name to fill items, e.g `fillDays` + items = that[f](); + that['$'+k].html(that.renderItems(items)); + } + }); + }, + + /* + Initialize items of combos. Handles `firstItem` option + */ + initItems: function(key) { + var values = []; + if(this.options.firstItem === 'name') { + var header = typeof moment.relativeTime[key] === 'function' ? moment.relativeTime[key](1, true, key, false) : moment.relativeTime[key]; + //take last entry (see momentjs lang files structure) + header = header.split(' ').reverse()[0]; + values.push(['', header]); + } else if(this.options.firstItem === 'empty') { + values.push(['', '']); + } + return values; + }, + + /* + render items to string of <option> tags + */ + renderItems: function(items) { + var str = []; + for(var i=0; i<items.length; i++) { + str.push('<option value="'+items[i][0]+'">'+items[i][1]+'</option>'); + } + return str.join("\n"); + }, + + /* + fill day + */ + fillDay: function() { + var items = this.initItems('d'), name, i, + twoDigit = this.options.template.indexOf('DD') !== -1; + + for(i=1; i<=31; i++) { + name = twoDigit ? this.leadZero(i) : i; + items.push([i, name]); + } + return items; + }, + + /* + fill month + */ + fillMonth: function() { + var items = this.initItems('M'), name, i, + longNames = this.options.template.indexOf('MMMM') !== -1, + shortNames = this.options.template.indexOf('MMM') !== -1, + twoDigit = this.options.template.indexOf('MM') !== -1; + + for(i=0; i<=11; i++) { + if(longNames) { + name = moment.months[i]; + } else if(shortNames) { + name = moment.monthsShort[i]; + } else if(twoDigit) { + name = this.leadZero(i+1); + } else { + name = i+1; + } + items.push([i, name]); + } + return items; + }, + + /* + fill year + */ + fillYear: function() { + var items = this.initItems('y'), name, i, + longNames = this.options.template.indexOf('YYYY') !== -1; + + for(i=this.options.maxYear; i>=this.options.minYear; i--) { + name = longNames ? i : (i+'').substring(2); + items.push([i, name]); + } + return items; + }, + + /* + fill hour + */ + fillHour: function() { + var items = this.initItems('h'), name, i, + h12 = this.options.template.indexOf('h') !== -1, + h24 = this.options.template.indexOf('H') !== -1, + twoDigit = this.options.template.toLowerCase().indexOf('hh') !== -1, + max = h12 ? 12 : 23; + + for(i=0; i<=max; i++) { + name = twoDigit ? this.leadZero(i) : i; + items.push([i, name]); + } + return items; + }, + + /* + fill minute + */ + fillMinute: function() { + var items = this.initItems('m'), name, i, + twoDigit = this.options.template.indexOf('mm') !== -1; + + for(i=0; i<=59; i+= this.options.minuteStep) { + name = twoDigit ? this.leadZero(i) : i; + items.push([i, name]); + } + return items; + }, + + /* + fill second + */ + fillSecond: function() { + var items = this.initItems('s'), name, i, + twoDigit = this.options.template.indexOf('ss') !== -1; + + for(i=0; i<=59; i+= this.options.secondStep) { + name = twoDigit ? this.leadZero(i) : i; + items.push([i, name]); + } + return items; + }, + + /* + fill ampm + */ + fillAmpm: function() { + var ampmL = this.options.template.indexOf('a') !== -1, + ampmU = this.options.template.indexOf('A') !== -1, + items = [ + ['am', ampmL ? 'am' : 'AM'], + ['pm', ampmL ? 'pm' : 'PM'] + ]; + return items; + }, + + /* + Returns current date value. + If format not specified - `options.format` used. + If format = `null` - Moment object returned. + */ + getValue: function(format) { + var dt, values = {}, + that = this, + notSelected = false; + + //getting selected values + $.each(this.map, function(k, v) { + if(k === 'ampm') { + return; + } + var def = k === 'day' ? 1 : 0; + + values[k] = that['$'+k] ? parseInt(that['$'+k].val(), 10) : def; + + if(isNaN(values[k])) { + notSelected = true; + return false; + } + }); + + //if at least one visible combo not selected - return empty string + if(notSelected) { + return ''; + } + + //convert hours if 12h format + if(this.$ampm) { + values.hour = this.$ampm.val() === 'am' ? values.hour : values.hour+12; + if(values.hour === 24) { + values.hour = 0; + } + } + + dt = moment([values.year, values.month, values.day, values.hour, values.minute, values.second]); + + //highlight invalid date + this.highlight(dt); + + format = format === undefined ? this.options.format : format; + if(format === null) { + return dt.isValid() ? dt : null; + } else { + return dt.isValid() ? dt.format(format) : ''; + } + }, + + setValue: function(value) { + if(!value) { + return; + } + + var dt = typeof value === 'string' ? moment(value, this.options.format) : moment(value), + that = this, + values = {}; + + if(dt.isValid()) { + //read values from date object + $.each(this.map, function(k, v) { + if(k === 'ampm') { + return; + } + values[k] = dt[v[1]](); + }); + + if(this.$ampm) { + if(values.hour > 12) { + values.hour -= 12; + values.ampm = 'pm'; + } else { + values.ampm = 'am'; + } + } + + $.each(values, function(k, v) { + if(that['$'+k]) { + that['$'+k].val(v); + } + }); + + this.$element.val(dt.format(this.options.format)); + } + }, + + /* + highlight combos if date is invalid + */ + highlight: function(dt) { + if(!dt.isValid()) { + if(this.options.errorClass) { + this.$widget.addClass(this.options.errorClass); + } else { + //store original border color + if(!this.borderColor) { + this.borderColor = this.$widget.find('select').css('border-color'); + } + this.$widget.find('select').css('border-color', 'red'); + } + } else { + if(this.options.errorClass) { + this.$widget.removeClass(this.options.errorClass); + } else { + this.$widget.find('select').css('border-color', this.borderColor); + } + } + }, + + leadZero: function(v) { + return v <= 9 ? '0' + v : v; + }, + + destroy: function() { + this.$widget.remove(); + this.$element.removeData('combodate').show(); + } + + //todo: clear method + }; + + $.fn.combodate = function ( option ) { + var d, args = Array.apply(null, arguments); + args.shift(); + + //getValue returns date as string / object (not jQuery object) + if(option === 'getValue' && this.length && (d = this.eq(0).data('combodate'))) { + return d.getValue.apply(d, args); + } + + return this.each(function () { + var $this = $(this), + data = $this.data('combodate'), + options = typeof option == 'object' && option; + if (!data) { + $this.data('combodate', (data = new Combodate(this, options))); + } + if (typeof option == 'string' && typeof data[option] == 'function') { + data[option].apply(data, args); + } + }); + }; + + $.fn.combodate.defaults = { + //in this format value stored in original input + format: 'DD-MM-YYYY HH:mm', + //in this format items in dropdowns are displayed + template: 'D / MMM / YYYY H : mm', + //initial value, can be `new Date()` + value: null, + minYear: 1970, + maxYear: 2015, + minuteStep: 5, + secondStep: 1, + firstItem: 'empty', //'name', 'empty', 'none' + errorClass: null + }; + +}(window.jQuery)); \ No newline at end of file diff --git a/src/inputs/combodate/lib/moment.min.js b/src/inputs/combodate/lib/moment.min.js new file mode 100644 index 0000000..67cb152 --- /dev/null +++ b/src/inputs/combodate/lib/moment.min.js @@ -0,0 +1,6 @@ +// moment.js +// version : 1.7.2 +// author : Tim Wood +// license : MIT +// momentjs.com +(function(a){function E(a,b,c,d){var e=c.lang();return e[a].call?e[a](c,d):e[a][b]}function F(a,b){return function(c){return K(a.call(this,c),b)}}function G(a){return function(b){var c=a.call(this,b);return c+this.lang().ordinal(c)}}function H(a,b,c){this._d=a,this._isUTC=!!b,this._a=a._a||null,this._lang=c||!1}function I(a){var b=this._data={},c=a.years||a.y||0,d=a.months||a.M||0,e=a.weeks||a.w||0,f=a.days||a.d||0,g=a.hours||a.h||0,h=a.minutes||a.m||0,i=a.seconds||a.s||0,j=a.milliseconds||a.ms||0;this._milliseconds=j+i*1e3+h*6e4+g*36e5,this._days=f+e*7,this._months=d+c*12,b.milliseconds=j%1e3,i+=J(j/1e3),b.seconds=i%60,h+=J(i/60),b.minutes=h%60,g+=J(h/60),b.hours=g%24,f+=J(g/24),f+=e*7,b.days=f%30,d+=J(f/30),b.months=d%12,c+=J(d/12),b.years=c,this._lang=!1}function J(a){return a<0?Math.ceil(a):Math.floor(a)}function K(a,b){var c=a+"";while(c.length<b)c="0"+c;return c}function L(a,b,c){var d=b._milliseconds,e=b._days,f=b._months,g;d&&a._d.setTime(+a+d*c),e&&a.date(a.date()+e*c),f&&(g=a.date(),a.date(1).month(a.month()+f*c).date(Math.min(g,a.daysInMonth())))}function M(a){return Object.prototype.toString.call(a)==="[object Array]"}function N(a,b){var c=Math.min(a.length,b.length),d=Math.abs(a.length-b.length),e=0,f;for(f=0;f<c;f++)~~a[f]!==~~b[f]&&e++;return e+d}function O(a,b,c,d){var e,f,g=[];for(e=0;e<7;e++)g[e]=a[e]=a[e]==null?e===2?1:0:a[e];return a[7]=g[7]=b,a[8]!=null&&(g[8]=a[8]),a[3]+=c||0,a[4]+=d||0,f=new Date(0),b?(f.setUTCFullYear(a[0],a[1],a[2]),f.setUTCHours(a[3],a[4],a[5],a[6])):(f.setFullYear(a[0],a[1],a[2]),f.setHours(a[3],a[4],a[5],a[6])),f._a=g,f}function P(a,c){var d,e,g=[];!c&&h&&(c=require("./lang/"+a));for(d=0;d<i.length;d++)c[i[d]]=c[i[d]]||f.en[i[d]];for(d=0;d<12;d++)e=b([2e3,d]),g[d]=new RegExp("^"+(c.months[d]||c.months(e,""))+"|^"+(c.monthsShort[d]||c.monthsShort(e,"")).replace(".",""),"i");return c.monthsParse=c.monthsParse||g,f[a]=c,c}function Q(a){var c=typeof a=="string"&&a||a&&a._lang||null;return c?f[c]||P(c):b}function R(a){return a.match(/\[.*\]/)?a.replace(/^\[|\]$/g,""):a.replace(/\\/g,"")}function S(a){var b=a.match(k),c,d;for(c=0,d=b.length;c<d;c++)D[b[c]]?b[c]=D[b[c]]:b[c]=R(b[c]);return function(e){var f="";for(c=0;c<d;c++)f+=typeof b[c].call=="function"?b[c].call(e,a):b[c];return f}}function T(a,b){function d(b){return a.lang().longDateFormat[b]||b}var c=5;while(c--&&l.test(b))b=b.replace(l,d);return A[b]||(A[b]=S(b)),A[b](a)}function U(a){switch(a){case"DDDD":return p;case"YYYY":return q;case"S":case"SS":case"SSS":case"DDD":return o;case"MMM":case"MMMM":case"dd":case"ddd":case"dddd":case"a":case"A":return r;case"Z":case"ZZ":return s;case"T":return t;case"MM":case"DD":case"YY":case"HH":case"hh":case"mm":case"ss":case"M":case"D":case"d":case"H":case"h":case"m":case"s":return n;default:return new RegExp(a.replace("\\",""))}}function V(a,b,c,d){var e,f;switch(a){case"M":case"MM":c[1]=b==null?0:~~b-1;break;case"MMM":case"MMMM":for(e=0;e<12;e++)if(Q().monthsParse[e].test(b)){c[1]=e,f=!0;break}f||(c[8]=!1);break;case"D":case"DD":case"DDD":case"DDDD":b!=null&&(c[2]=~~b);break;case"YY":c[0]=~~b+(~~b>70?1900:2e3);break;case"YYYY":c[0]=~~Math.abs(b);break;case"a":case"A":d.isPm=(b+"").toLowerCase()==="pm";break;case"H":case"HH":case"h":case"hh":c[3]=~~b;break;case"m":case"mm":c[4]=~~b;break;case"s":case"ss":c[5]=~~b;break;case"S":case"SS":case"SSS":c[6]=~~(("0."+b)*1e3);break;case"Z":case"ZZ":d.isUTC=!0,e=(b+"").match(x),e&&e[1]&&(d.tzh=~~e[1]),e&&e[2]&&(d.tzm=~~e[2]),e&&e[0]==="+"&&(d.tzh=-d.tzh,d.tzm=-d.tzm)}b==null&&(c[8]=!1)}function W(a,b){var c=[0,0,1,0,0,0,0],d={tzh:0,tzm:0},e=b.match(k),f,g;for(f=0;f<e.length;f++)g=(U(e[f]).exec(a)||[])[0],g&&(a=a.slice(a.indexOf(g)+g.length)),D[e[f]]&&V(e[f],g,c,d);return d.isPm&&c[3]<12&&(c[3]+=12),d.isPm===!1&&c[3]===12&&(c[3]=0),O(c,d.isUTC,d.tzh,d.tzm)}function X(a,b){var c,d=a.match(m)||[],e,f=99,g,h,i;for(g=0;g<b.length;g++)h=W(a,b[g]),e=T(new H(h),b[g]).match(m)||[],i=N(d,e),i<f&&(f=i,c=h);return c}function Y(a){var b="YYYY-MM-DDT",c;if(u.exec(a)){for(c=0;c<4;c++)if(w[c][1].exec(a)){b+=w[c][0];break}return s.exec(a)?W(a,b+" Z"):W(a,b)}return new Date(a)}function Z(a,b,c,d,e){var f=e.relativeTime[a];return typeof f=="function"?f(b||1,!!c,a,d):f.replace(/%d/i,b||1)}function $(a,b,c){var e=d(Math.abs(a)/1e3),f=d(e/60),g=d(f/60),h=d(g/24),i=d(h/365),j=e<45&&["s",e]||f===1&&["m"]||f<45&&["mm",f]||g===1&&["h"]||g<22&&["hh",g]||h===1&&["d"]||h<=25&&["dd",h]||h<=45&&["M"]||h<345&&["MM",d(h/30)]||i===1&&["y"]||["yy",i];return j[2]=b,j[3]=a>0,j[4]=c,Z.apply({},j)}function _(a,c){b.fn[a]=function(a){var b=this._isUTC?"UTC":"";return a!=null?(this._d["set"+b+c](a),this):this._d["get"+b+c]()}}function ab(a){b.duration.fn[a]=function(){return this._data[a]}}function bb(a,c){b.duration.fn["as"+a]=function(){return+this/c}}var b,c="1.7.2",d=Math.round,e,f={},g="en",h=typeof module!="undefined"&&module.exports,i="months|monthsShort|weekdays|weekdaysShort|weekdaysMin|longDateFormat|calendar|relativeTime|ordinal|meridiem".split("|"),j=/^\/?Date\((\-?\d+)/i,k=/(\[[^\[]*\])|(\\)?(Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|YYYY|YY|a|A|hh?|HH?|mm?|ss?|SS?S?|zz?|ZZ?|.)/g,l=/(\[[^\[]*\])|(\\)?(LT|LL?L?L?)/g,m=/([0-9a-zA-Z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+)/gi,n=/\d\d?/,o=/\d{1,3}/,p=/\d{3}/,q=/\d{1,4}/,r=/[0-9a-z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+/i,s=/Z|[\+\-]\d\d:?\d\d/i,t=/T/i,u=/^\s*\d{4}-\d\d-\d\d(T(\d\d(:\d\d(:\d\d(\.\d\d?\d?)?)?)?)?([\+\-]\d\d:?\d\d)?)?/,v="YYYY-MM-DDTHH:mm:ssZ",w=[["HH:mm:ss.S",/T\d\d:\d\d:\d\d\.\d{1,3}/],["HH:mm:ss",/T\d\d:\d\d:\d\d/],["HH:mm",/T\d\d:\d\d/],["HH",/T\d\d/]],x=/([\+\-]|\d\d)/gi,y="Month|Date|Hours|Minutes|Seconds|Milliseconds".split("|"),z={Milliseconds:1,Seconds:1e3,Minutes:6e4,Hours:36e5,Days:864e5,Months:2592e6,Years:31536e6},A={},B="DDD w M D d".split(" "),C="M D H h m s w".split(" "),D={M:function(){return this.month()+1},MMM:function(a){return E("monthsShort",this.month(),this,a)},MMMM:function(a){return E("months",this.month(),this,a)},D:function(){return this.date()},DDD:function(){var a=new Date(this.year(),this.month(),this.date()),b=new Date(this.year(),0,1);return~~((a-b)/864e5+1.5)},d:function(){return this.day()},dd:function(a){return E("weekdaysMin",this.day(),this,a)},ddd:function(a){return E("weekdaysShort",this.day(),this,a)},dddd:function(a){return E("weekdays",this.day(),this,a)},w:function(){var a=new Date(this.year(),this.month(),this.date()-this.day()+5),b=new Date(a.getFullYear(),0,4);return~~((a-b)/864e5/7+1.5)},YY:function(){return K(this.year()%100,2)},YYYY:function(){return K(this.year(),4)},a:function(){return this.lang().meridiem(this.hours(),this.minutes(),!0)},A:function(){return this.lang().meridiem(this.hours(),this.minutes(),!1)},H:function(){return this.hours()},h:function(){return this.hours()%12||12},m:function(){return this.minutes()},s:function(){return this.seconds()},S:function(){return~~(this.milliseconds()/100)},SS:function(){return K(~~(this.milliseconds()/10),2)},SSS:function(){return K(this.milliseconds(),3)},Z:function(){var a=-this.zone(),b="+";return a<0&&(a=-a,b="-"),b+K(~~(a/60),2)+":"+K(~~a%60,2)},ZZ:function(){var a=-this.zone(),b="+";return a<0&&(a=-a,b="-"),b+K(~~(10*a/6),4)}};while(B.length)e=B.pop(),D[e+"o"]=G(D[e]);while(C.length)e=C.pop(),D[e+e]=F(D[e],2);D.DDDD=F(D.DDD,3),b=function(c,d){if(c===null||c==="")return null;var e,f;return b.isMoment(c)?new H(new Date(+c._d),c._isUTC,c._lang):(d?M(d)?e=X(c,d):e=W(c,d):(f=j.exec(c),e=c===a?new Date:f?new Date(+f[1]):c instanceof Date?c:M(c)?O(c):typeof c=="string"?Y(c):new Date(c)),new H(e))},b.utc=function(a,c){return M(a)?new H(O(a,!0),!0):(typeof a=="string"&&!s.exec(a)&&(a+=" +0000",c&&(c+=" Z")),b(a,c).utc())},b.unix=function(a){return b(a*1e3)},b.duration=function(a,c){var d=b.isDuration(a),e=typeof a=="number",f=d?a._data:e?{}:a,g;return e&&(c?f[c]=a:f.milliseconds=a),g=new I(f),d&&(g._lang=a._lang),g},b.humanizeDuration=function(a,c,d){return b.duration(a,c===!0?null:c).humanize(c===!0?!0:d)},b.version=c,b.defaultFormat=v,b.lang=function(a,c){var d;if(!a)return g;(c||!f[a])&&P(a,c);if(f[a]){for(d=0;d<i.length;d++)b[i[d]]=f[a][i[d]];b.monthsParse=f[a].monthsParse,g=a}},b.langData=Q,b.isMoment=function(a){return a instanceof H},b.isDuration=function(a){return a instanceof I},b.lang("en",{months:"January_February_March_April_May_June_July_August_September_October_November_December".split("_"),monthsShort:"Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"),weekdays:"Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),weekdaysShort:"Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"),weekdaysMin:"Su_Mo_Tu_We_Th_Fr_Sa".split("_"),longDateFormat:{LT:"h:mm A",L:"MM/DD/YYYY",LL:"MMMM D YYYY",LLL:"MMMM D YYYY LT",LLLL:"dddd, MMMM D YYYY LT"},meridiem:function(a,b,c){return a>11?c?"pm":"PM":c?"am":"AM"},calendar:{sameDay:"[Today at] LT",nextDay:"[Tomorrow at] LT",nextWeek:"dddd [at] LT",lastDay:"[Yesterday at] LT",lastWeek:"[last] dddd [at] LT",sameElse:"L"},relativeTime:{future:"in %s",past:"%s ago",s:"a few seconds",m:"a minute",mm:"%d minutes",h:"an hour",hh:"%d hours",d:"a day",dd:"%d days",M:"a month",MM:"%d months",y:"a year",yy:"%d years"},ordinal:function(a){var b=a%10;return~~(a%100/10)===1?"th":b===1?"st":b===2?"nd":b===3?"rd":"th"}}),b.fn=H.prototype={clone:function(){return b(this)},valueOf:function(){return+this._d},unix:function(){return Math.floor(+this._d/1e3)},toString:function(){return this._d.toString()},toDate:function(){return this._d},toArray:function(){var a=this;return[a.year(),a.month(),a.date(),a.hours(),a.minutes(),a.seconds(),a.milliseconds(),!!this._isUTC]},isValid:function(){return this._a?this._a[8]!=null?!!this._a[8]:!N(this._a,(this._a[7]?b.utc(this._a):b(this._a)).toArray()):!isNaN(this._d.getTime())},utc:function(){return this._isUTC=!0,this},local:function(){return this._isUTC=!1,this},format:function(a){return T(this,a?a:b.defaultFormat)},add:function(a,c){var d=c?b.duration(+c,a):b.duration(a);return L(this,d,1),this},subtract:function(a,c){var d=c?b.duration(+c,a):b.duration(a);return L(this,d,-1),this},diff:function(a,c,e){var f=this._isUTC?b(a).utc():b(a).local(),g=(this.zone()-f.zone())*6e4,h=this._d-f._d-g,i=this.year()-f.year(),j=this.month()-f.month(),k=this.date()-f.date(),l;return c==="months"?l=i*12+j+k/30:c==="years"?l=i+(j+k/30)/12:l=c==="seconds"?h/1e3:c==="minutes"?h/6e4:c==="hours"?h/36e5:c==="days"?h/864e5:c==="weeks"?h/6048e5:h,e?l:d(l)},from:function(a,c){return b.duration(this.diff(a)).lang(this._lang).humanize(!c)},fromNow:function(a){return this.from(b(),a)},calendar:function(){var a=this.diff(b().sod(),"days",!0),c=this.lang().calendar,d=c.sameElse,e=a<-6?d:a<-1?c.lastWeek:a<0?c.lastDay:a<1?c.sameDay:a<2?c.nextDay:a<7?c.nextWeek:d;return this.format(typeof e=="function"?e.apply(this):e)},isLeapYear:function(){var a=this.year();return a%4===0&&a%100!==0||a%400===0},isDST:function(){return this.zone()<b([this.year()]).zone()||this.zone()<b([this.year(),5]).zone()},day:function(a){var b=this._isUTC?this._d.getUTCDay():this._d.getDay();return a==null?b:this.add({d:a-b})},startOf:function(a){switch(a.replace(/s$/,"")){case"year":this.month(0);case"month":this.date(1);case"day":this.hours(0);case"hour":this.minutes(0);case"minute":this.seconds(0);case"second":this.milliseconds(0)}return this},endOf:function(a){return this.startOf(a).add(a.replace(/s?$/,"s"),1).subtract("ms",1)},sod:function(){return this.clone().startOf("day")},eod:function(){return this.clone().endOf("day")},zone:function(){return this._isUTC?0:this._d.getTimezoneOffset()},daysInMonth:function(){return b.utc([this.year(),this.month()+1,0]).date()},lang:function(b){return b===a?Q(this):(this._lang=b,this)}};for(e=0;e<y.length;e++)_(y[e].toLowerCase(),y[e]);_("year","FullYear"),b.duration.fn=I.prototype={weeks:function(){return J(this.days()/7)},valueOf:function(){return this._milliseconds+this._days*864e5+this._months*2592e6},humanize:function(a){var b=+this,c=this.lang().relativeTime,d=$(b,!a,this.lang()),e=b<=0?c.past:c.future;return a&&(typeof e=="function"?d=e(d):d=e.replace(/%s/i,d)),d},lang:b.fn.lang};for(e in z)z.hasOwnProperty(e)&&(bb(e,z[e]),ab(e.toLowerCase()));bb("Weeks",6048e5),h&&(module.exports=b),typeof ender=="undefined"&&(this.moment=b),typeof define=="function"&&define.amd&&define("moment",[],function(){return b})}).call(this); \ No newline at end of file diff --git a/test/loader.js b/test/loader.js index 5fa9de7..291c881 100644 --- a/test/loader.js +++ b/test/loader.js @@ -31,6 +31,7 @@ define(function () { loadCss(require.toUrl("./editable-element.css")); } }, + //default inputs 'editable-form/editable-form': { deps: ['require', 'inputs/text', @@ -38,6 +39,7 @@ define(function () { 'inputs/select', 'inputs/checklist', 'inputs/html5types', + 'inputs/combodate/combodate', 'inputs-ext/address/address'], init: function(require) { loadCss(require.toUrl("./editable-form.css")); @@ -49,7 +51,8 @@ define(function () { 'inputs/text': ['inputs/abstract'], 'inputs/textarea': ['inputs/abstract'], 'inputs/abstract': ['editable-form/editable-form-utils'], - 'inputs/html5types': ['inputs/text'], + 'inputs/html5types': ['inputs/text'], + 'inputs/combodate/combodate': ['inputs/abstract', 'inputs/combodate/lib/combodate', 'inputs/combodate/lib/moment.min'], /* bootstrap diff --git a/test/main.js b/test/main.js index ee32ab3..0863c1c 100644 --- a/test/main.js +++ b/test/main.js @@ -44,7 +44,8 @@ require(["loader", jqurl], function(loader) { 'test/unit/text', 'test/unit/textarea', 'test/unit/select', - 'test/unit/checklist' + 'test/unit/checklist', + 'test/unit/combodate' ]; tests = tests.concat(custom); tests.push('test/unit/api'); diff --git a/test/unit/combodate.js b/test/unit/combodate.js new file mode 100644 index 0000000..7e0f275 --- /dev/null +++ b/test/unit/combodate.js @@ -0,0 +1,107 @@ +$(function () { + + //formats + var + fd = 'DD.MM.YYYY', vfd = 'DD-MM-YYYY', vd = '15-05-1984', + fdt = 'DD-MM-YYYY hh:mm:ss A', vfdt = 'DD MMM YYYY h:m:s a', vdt = '15-05-1984 08:20:30 PM'; + + + module("combodate", { + setup: function(){ + fx = $('#async-fixture'); + $.support.transition = false; + } + }); + + asyncTest("container should contain combodate and save new value (date)", function () { + + var e = $('<a href="#" data-type="combodate" data-pk="1" data-url="/combodate">'+vd+'</a>').appendTo(fx).editable({ + format: fd, + viewformat: vfd, + template: fd + }), + m = moment(vd, vfd); + + $.mockjax({ + url: '/combodate', + response: function(settings) { + equal(settings.data.value, m.format(fd), 'submitted value correct'); + } + }); + + equal(e.data('editable').value.format(fd), m.format(fd), 'init value correct'); + + e.click(); + var p = tip(e); + ok(p.find('.combodate').is(':visible'), 'combodate exists'); + equal(p.find('.day, .month, .year, .hour, .minute').length, 3, 'combos correct'); + + equal(p.find('.day').val(), m.date(), 'day set correct'); + equal(p.find('.month').val(), m.month(), 'month set correct'); + equal(p.find('.year').val(), m.year(), 'year set correct'); + + //set new day + p.find('.day').val(16).trigger('change'); + m.date(16); + p.find('form').submit(); + + setTimeout(function() { + ok(!p.is(':visible'), 'container closed'); + equal(e.data('editable').value.format(fd), m.format(fd), 'new value correct'); + equal(e.text(), m.format(vfd), 'new text correct'); + e.remove(); + start(); + }, timeout); + + }); + + asyncTest("container should contain combodate and save new value (datetime)", function () { + + var e = $('<a href="#" data-type="combodate" data-pk="1" data-url="/combodate-dt" data-value="'+vdt+'"></a>').appendTo(fx).editable({ + format: fdt, + viewformat: vfdt, + template: fdt + }), + m = moment(vdt, fdt); + + $.mockjax({ + url: '/combodate-dt', + response: function(settings) { + equal(settings.data.value, m.format(fdt), 'submitted value correct'); + } + }); + + equal(e.data('editable').value.format(fdt), m.format(fdt), 'init value correct'); + equal(e.text(), m.format(vfdt), 'init text correct'); + + e.click(); + var p = tip(e); + ok(p.find('.combodate').is(':visible'), 'combodate exists'); + equal(p.find('.day, .month, .year, .hour, .minute, .second, .ampm').length, 7, 'combos correct'); + + equal(p.find('.day').val(), m.date(), 'day set correct'); + equal(p.find('.month').val(), m.month(), 'month set correct'); + equal(p.find('.year').val(), m.year(), 'year set correct'); + equal(p.find('.hour').val(), m.hours()-12, 'hour set correct'); + equal(p.find('.minute').val(), m.minutes(), 'minute set correct'); + equal(p.find('.second').val(), m.seconds(), 'second set correct'); + equal(p.find('.ampm').val(), 'pm', 'ampm set correct'); + + //set new day + p.find('.day').val(16).trigger('change'); + p.find('.hour').val(9).trigger('change'); + m.date(16); + m.hours(21); + p.find('form').submit(); + + setTimeout(function() { + ok(!p.is(':visible'), 'container closed'); + equal(e.data('editable').value.format(fdt), m.format(fdt), 'new value correct'); + equal(e.text(), m.format(vfdt), 'new text correct'); + e.remove(); + start(); + }, timeout); + + }); + +}); \ No newline at end of file