From a3b21b8f4b8e8ae2af37fe580a8efe2e5726f8ac Mon Sep 17 00:00:00 2001
From: vitalets <noginsk@rambler.ru>
Date: Thu, 10 Jan 2013 22:13:28 +0400
Subject: [PATCH] combodate ready

---
 src/containers/editable-popover.js     |  15 +-
 src/inputs/combodate/combodate.js      | 184 ++++++++++++
 src/inputs/combodate/lib/combodate.js  | 398 +++++++++++++++++++++++++
 src/inputs/combodate/lib/moment.min.js |   6 +
 test/loader.js                         |   5 +-
 test/main.js                           |   3 +-
 test/unit/combodate.js                 | 107 +++++++
 7 files changed, 715 insertions(+), 3 deletions(-)
 create mode 100644 src/inputs/combodate/combodate.js
 create mode 100644 src/inputs/combodate/lib/combodate.js
 create mode 100644 src/inputs/combodate/lib/moment.min.js
 create mode 100644 test/unit/combodate.js

diff --git a/src/containers/editable-popover.js b/src/containers/editable-popover.js
index ab540f2..027043e 100644
--- a/src/containers/editable-popover.js
+++ b/src/containers/editable-popover.js
@@ -15,9 +15,22 @@
             $.extend(this.containerOptions, {
                 trigger: 'manual',
                 selector: false,
-                content: ' '
+                content: ' ',
+                template: $.fn.popover.defaults.template
             });
+            
+            //as template property is used in inputs, hide it from popover
+            var t;
+            if(this.$element.data('template')) {
+               t = this.$element.data('template');
+               this.$element.removeData('template');  
+            } 
+            
             this.call(this.containerOptions);
+            
+            if(t) {
+               this.$element.data('template', t); 
+            }
         },        
         
         setContainerOption: function(key, value) {
diff --git a/src/inputs/combodate/combodate.js b/src/inputs/combodate/combodate.js
new file mode 100644
index 0000000..6f25eb1
--- /dev/null
+++ b/src/inputs/combodate/combodate.js
@@ -0,0 +1,184 @@
+/**
+Combodate input - dropdown date and time picker.  
+Based on [combodate](http://vitalets.github.com/combodate) plugin.
+To use it you should manually include [momentjs](http://momentjs.com). 
+Allows to enter:
+
+* only date
+* only time 
+* datetime  
+
+Please note, that format is taken from momentjs and not compatible with bootstrap-datepicker / jquery UI datepicker.
+Internally value stored as Moment js object 
+
+@class combodate
+@extends abstractinput
+@final
+@example
+<a href="#" id="dob" data-type="combodate" data-pk="1" data-url="/post" data-value="1984-05-15" data-original-title="Select date"></a>
+<script>
+$(function(){
+    $('#dob').editable({
+        format: 'YYYY-MM-DD',    
+        viewformat: 'YYYY-MM-DD',    
+        template: 'D / MMMM / YYYY',    
+        combodate: {
+                minYear: 2000,
+                maxYear: 2015,
+                minuteStep: 1
+           }
+        }
+    });
+});
+</script>
+**/
+(function ($) {
+
+    var Constructor = function (options) {
+        this.init('combodate', options, Constructor.defaults);
+        
+        //by default viewformat equals to format
+        if(!this.options.viewformat) {
+            this.options.viewformat = this.options.format;
+        }        
+        
+        //overriding combodate config (as by default jQuery extend() is not recursive)
+        this.options.combodate = $.extend({}, Constructor.defaults.combodate, options.combodate, {
+            format: this.options.format,
+            template: this.options.template
+        });
+    };
+
+    $.fn.editableutils.inherit(Constructor, $.fn.editabletypes.abstractinput);    
+    
+    $.extend(Constructor.prototype, {
+        render: function () {
+            this.$input.combodate(this.options.combodate);
+            
+            //"clear" link
+            /*
+            if(this.options.clear) {
+                this.$clear = $('<a href="#"></a>').html(this.options.clear).click($.proxy(function(e){
+                    e.preventDefault();
+                    e.stopPropagation();
+                    this.clear();
+                }, this));
+                
+                this.$tpl.parent().append($('<div class="editable-clear">').append(this.$clear));  
+            } 
+            */               
+        },
+        
+        value2html: function(value, element) {
+            var text = value ? value.format(this.options.viewformat) : '';
+            $(element).text(text); 
+        },
+
+        html2value: function(html) {
+            return html ? moment(html, this.options.viewformat) : null;
+        },   
+        
+        value2str: function(value) {
+            return value ? value.format(this.options.format) : '';
+       }, 
+       
+       str2value: function(str) {
+           return str ? moment(str, this.options.format) : null;
+       }, 
+       
+       value2submit: function(value) {
+           return this.value2str(value);
+       },                    
+
+       value2input: function(value) {
+           this.$input.combodate('setValue', value);
+       },
+        
+       input2value: function() { 
+           return this.$input.combodate('getValue', null);
+       },       
+       
+       activate: function() {
+           this.$input.siblings('.combodate').find('select').eq(0).focus();
+       },
+       
+       /*
+       clear:  function() {
+          this.$input.data('datepicker').date = null;
+          this.$input.find('.active').removeClass('active');
+       },
+       */
+       
+       autosubmit: function() {
+           
+       }
+
+    });
+    
+    Constructor.defaults = $.extend({}, $.fn.editabletypes.abstractinput.defaults, {
+        /**
+        @property tpl 
+        @default <input type="text">
+        **/         
+        tpl:'<input type="text">',
+        /**
+        @property inputclass 
+        @default null
+        **/         
+        inputclass: null,
+        /**
+        Format used for sending value to server. Also applied when converting date from <code>data-value</code> attribute.<br>
+        See list of tokens in [momentjs docs](http://momentjs.com/docs/#/parsing/string-format)  
+        
+        @property format 
+        @type string
+        @default YYYY-MM-DD
+        **/         
+        format:'YYYY-MM-DD',
+        /**
+        Format used for displaying date. Also applied when converting date from element's text on init.   
+        If not specified equals to `format`.
+        
+        @property viewformat 
+        @type string
+        @default null
+        **/          
+        viewformat: null,        
+        /**
+        Template used for displaying dropdowns.
+        
+        @property template 
+        @type string
+        @default D / MMM / YYYY
+        **/          
+        template: 'D / MMM / YYYY',  
+        /**
+        Configuration of combodate.
+        Full list of options: http://vitalets.github.com/combodate/#docs
+        
+        @property datepicker 
+        @type object
+        @default {
+            weekStart: 0,
+            startView: 0,
+            autoclose: false
+        }
+        **/
+        combodate: {
+        },
+        
+        /*
+        (not implemented yet)
+        Text shown as clear date button. 
+        If <code>false</code> clear button will not be rendered.
+        
+        @property clear 
+        @type boolean|string
+        @default 'x clear'         
+        */
+        //clear: '&times; clear'
+    });   
+
+    $.fn.editabletypes.combodate = Constructor;
+
+}(window.jQuery));
diff --git a/src/inputs/combodate/lib/combodate.js b/src/inputs/combodate/lib/combodate.js
new file mode 100644
index 0000000..e27adff
--- /dev/null
+++ b/src/inputs/combodate/lib/combodate.js
@@ -0,0 +1,398 @@
+/**
+* Combodate - 1.0.0
+* Dropdown date and time picker.
+* Converts text input into dropdowns to pick day, month, year, hour, minute and second.
+* Uses momentjs as datetime library http://momentjs.com.
+* For i18n include corresponding file from https://github.com/timrwood/moment/tree/master/lang 
+*
+* Author: Vitaliy Potapov
+* Project page: http://github.com/vitalets/combodate
+* Copyright (c) 2012 Vitaliy Potapov. Released under MIT License.
+**/
+(function ($) {
+
+    var Combodate = function (element, options) {
+        this.$element = $(element);
+        if(!this.$element.is('input')) {
+            $.error('Combodate should be applied to INPUT element');
+            return;
+        }
+        this.options = $.extend({}, $.fn.combodate.defaults, options, this.$element.data());
+        this.init();  
+     };
+
+    Combodate.prototype = {
+        constructor: Combodate, 
+        init: function () {
+            this.map = {
+                //key   regexp    moment.method
+                day:    ['D',    'date'], 
+                month:  ['M',    'month'], 
+                year:   ['Y',    'year'], 
+                hour:   ['[Hh]', 'hours'],
+                minute: ['m',    'minutes'], 
+                second: ['s',    'seconds'],
+                ampm:   ['[Aa]', ''] 
+            };
+            
+            this.$widget = $('<span class="combodate"></span>').html(this.getTemplate());
+                      
+            this.initCombos();
+            
+            //update original input on change 
+            this.$widget.on('change', 'select', $.proxy(function(){
+                this.$element.val(this.getValue());
+            }, this));
+            
+            this.$widget.find('select').css('width', 'auto');
+                                       
+            //hide original input and insert widget                                       
+            this.$element.hide().after(this.$widget);
+            
+            //set initial value
+            this.setValue(this.$element.val() || this.options.value);
+        },
+        
+        /*
+         Replace tokens in template with <select> elements 
+        */         
+        getTemplate: function() {
+            var tpl = this.options.template;
+
+            //first pass
+            $.each(this.map, function(k, v) {
+                var v = v[0], 
+                    r = new RegExp(v+'+'),
+                    token = v.length > 1 ? v.substring(1, 2) : v;
+                    
+                tpl = tpl.replace(r, '{'+token+'}');
+            });
+
+            //replace spaces with &nbsp;
+            tpl = tpl.replace(/ /g, '&nbsp;');
+
+            //second pass
+            $.each(this.map, function(k, v) {
+                var v = v[0],
+                    token = v.length > 1 ? v.substring(1, 2) : v;
+                    
+                tpl = tpl.replace('{'+token+'}', '<select class="'+k+'"></select>');
+            });   
+
+            return tpl;
+        },
+        
+        /*
+         Initialize combos that presents in template 
+        */        
+        initCombos: function() {
+            var that = this;
+            $.each(this.map, function(k, v) {
+               var $c = that.$widget.find('.'+k), f, items;
+               if($c.length) {
+                   that['$'+k] = $c; //set properties like this.$day, this.$month etc.
+                   f = 'fill' + k.charAt(0).toUpperCase() + k.slice(1); //define method name to fill items, e.g `fillDays`
+                   items = that[f](); 
+                   that['$'+k].html(that.renderItems(items));
+               }
+            }); 
+        },
+        
+        /*
+         Initialize items of combos. Handles `firstItem` option 
+        */
+        initItems: function(key) {
+            var values = [];
+            if(this.options.firstItem === 'name') {
+                var header = typeof moment.relativeTime[key] === 'function' ? moment.relativeTime[key](1, true, key, false) : moment.relativeTime[key];
+                //take last entry (see momentjs lang files structure) 
+                header = header.split(' ').reverse()[0];                
+                values.push(['', header]);
+            } else if(this.options.firstItem === 'empty') {
+                values.push(['', '']);
+            }
+            return values;
+        },        
+        
+        /*
+        render items to string of <option> tags
+        */
+        renderItems: function(items) {
+            var str = [];
+            for(var i=0; i<items.length; i++) {
+                str.push('<option value="'+items[i][0]+'">'+items[i][1]+'</option>');                
+            }
+            return str.join("\n");
+        },        
+
+        /*
+        fill day
+        */
+        fillDay: function() {
+            var items = this.initItems('d'), name, i,
+                twoDigit = this.options.template.indexOf('DD') !== -1;
+                
+            for(i=1; i<=31; i++) {
+                name = twoDigit ? this.leadZero(i) : i;
+                items.push([i, name]);
+            }
+            return items;        
+        },
+        
+        /*
+        fill month
+        */
+        fillMonth: function() {
+            var items = this.initItems('M'), name, i, 
+                longNames = this.options.template.indexOf('MMMM') !== -1,
+                shortNames = this.options.template.indexOf('MMM') !== -1,
+                twoDigit = this.options.template.indexOf('MM') !== -1;
+                
+            for(i=0; i<=11; i++) {
+                if(longNames) {
+                    name = moment.months[i];
+                } else if(shortNames) {
+                    name = moment.monthsShort[i];
+                } else if(twoDigit) {
+                    name = this.leadZero(i+1);
+                } else {
+                    name = i+1;
+                }
+                items.push([i, name]);
+            } 
+            return items;
+        },  
+        
+        /*
+        fill year
+        */
+        fillYear: function() {
+            var items = this.initItems('y'), name, i, 
+                longNames = this.options.template.indexOf('YYYY') !== -1;
+
+            for(i=this.options.maxYear; i>=this.options.minYear; i--) {
+                name = longNames ? i : (i+'').substring(2);
+                items.push([i, name]);
+            }    
+            return items;              
+        },    
+        
+        /*
+        fill hour
+        */
+        fillHour: function() {
+            var items = this.initItems('h'), name, i,
+                h12 = this.options.template.indexOf('h') !== -1,
+                h24 = this.options.template.indexOf('H') !== -1,
+                twoDigit = this.options.template.toLowerCase().indexOf('hh') !== -1,
+                max = h12 ? 12 : 23;
+                
+            for(i=0; i<=max; i++) {
+                name = twoDigit ? this.leadZero(i) : i;
+                items.push([i, name]);
+            } 
+            return items;                 
+        },    
+        
+        /*
+        fill minute
+        */
+        fillMinute: function() {
+            var items = this.initItems('m'), name, i,
+                twoDigit = this.options.template.indexOf('mm') !== -1;
+
+            for(i=0; i<=59; i+= this.options.minuteStep) {
+                name = twoDigit ? this.leadZero(i) : i;
+                items.push([i, name]);
+            }    
+            return items;              
+        },  
+        
+        /*
+        fill second
+        */
+        fillSecond: function() {
+            var items = this.initItems('s'), name, i,
+                twoDigit = this.options.template.indexOf('ss') !== -1;
+
+            for(i=0; i<=59; i+= this.options.secondStep) {
+                name = twoDigit ? this.leadZero(i) : i;
+                items.push([i, name]);
+            }    
+            return items;              
+        },  
+        
+        /*
+        fill ampm
+        */
+        fillAmpm: function() {
+            var ampmL = this.options.template.indexOf('a') !== -1,
+                ampmU = this.options.template.indexOf('A') !== -1,            
+                items = [
+                    ['am', ampmL ? 'am' : 'AM'],
+                    ['pm', ampmL ? 'pm' : 'PM']
+                ];
+            return items;                              
+        },                                       
+        
+        /*
+         Returns current date value. 
+         If format not specified - `options.format` used.
+         If format = `null` - Moment object returned.
+        */
+        getValue: function(format) {
+            var dt, values = {}, 
+                that = this,
+                notSelected = false;
+                
+            //getting selected values    
+            $.each(this.map, function(k, v) {
+                if(k === 'ampm') {
+                    return;
+                }
+                var def = k === 'day' ? 1 : 0;
+                  
+                values[k] = that['$'+k] ? parseInt(that['$'+k].val(), 10) : def; 
+                
+                if(isNaN(values[k])) {
+                   notSelected = true;
+                   return false; 
+                }
+            });
+            
+            //if at least one visible combo not selected - return empty string
+            if(notSelected) {
+               return '';
+            }
+            
+            //convert hours if 12h format
+            if(this.$ampm) {
+               values.hour = this.$ampm.val() === 'am' ? values.hour : values.hour+12;
+               if(values.hour === 24) {
+                   values.hour = 0;
+               }  
+            }    
+            
+            dt = moment([values.year, values.month, values.day, values.hour, values.minute, values.second]);
+            
+            //highlight invalid date
+            this.highlight(dt);
+                              
+            format = format === undefined ? this.options.format : format;
+            if(format === null) {
+               return dt.isValid() ? dt : null; 
+            } else {
+               return dt.isValid() ? dt.format(format) : ''; 
+            }           
+        },
+        
+        setValue: function(value) {
+            if(!value) {
+                return;
+            }
+            
+            var dt = typeof value === 'string' ? moment(value, this.options.format) : moment(value),
+                that = this,
+                values = {};
+            
+            if(dt.isValid()) {
+                 //read values from date object
+                 $.each(this.map, function(k, v) {
+                     if(k === 'ampm') {
+                         return; 
+                     }
+                     values[k] = dt[v[1]]();
+                 });
+               
+               if(this.$ampm) {
+                   if(values.hour > 12) {
+                       values.hour -= 12;
+                       values.ampm = 'pm';
+                   } else {
+                       values.ampm = 'am';                  
+                   } 
+               }
+               
+               $.each(values, function(k, v) {
+                   if(that['$'+k]) {
+                       that['$'+k].val(v);                       
+                   }
+               });
+               
+               this.$element.val(dt.format(this.options.format));
+            }
+        },
+        
+        /*
+         highlight combos if date is invalid
+        */
+        highlight: function(dt) {
+            if(!dt.isValid()) {
+                if(this.options.errorClass) {
+                    this.$widget.addClass(this.options.errorClass);
+                } else {
+                    //store original border color
+                    if(!this.borderColor) {
+                        this.borderColor = this.$widget.find('select').css('border-color'); 
+                    }
+                    this.$widget.find('select').css('border-color', 'red');
+                } 
+            } else {
+                if(this.options.errorClass) {
+                    this.$widget.removeClass(this.options.errorClass);
+                } else {
+                    this.$widget.find('select').css('border-color', this.borderColor);
+                }  
+            }
+        },
+        
+        leadZero: function(v) {
+            return v <= 9 ? '0' + v : v; 
+        },
+        
+        destroy: function() {
+            this.$widget.remove();
+            this.$element.removeData('combodate').show();
+        }
+        
+        //todo: clear method        
+    };
+
+    $.fn.combodate = function ( option ) {
+        var d, args = Array.apply(null, arguments);
+        args.shift();
+
+        //getValue returns date as string / object (not jQuery object)
+        if(option === 'getValue' && this.length && (d = this.eq(0).data('combodate'))) {
+          return d.getValue.apply(d, args);
+        }        
+        
+        return this.each(function () {
+            var $this = $(this),
+            data = $this.data('combodate'),
+            options = typeof option == 'object' && option;
+            if (!data) {
+                $this.data('combodate', (data = new Combodate(this, options)));
+            }
+            if (typeof option == 'string' && typeof data[option] == 'function') {
+                data[option].apply(data, args);
+            }
+        });
+    };  
+    
+    $.fn.combodate.defaults = {
+         //in this format value stored in original input
+        format: 'DD-MM-YYYY HH:mm',      
+        //in this format items in dropdowns are displayed
+        template: 'D / MMM / YYYY   H : mm',
+        //initial value, can be `new Date()`    
+        value: null,                       
+        minYear: 1970,
+        maxYear: 2015,
+        minuteStep: 5,
+        secondStep: 1,
+        firstItem: 'empty', //'name', 'empty', 'none'
+        errorClass: null
+    };
+
+}(window.jQuery));
\ No newline at end of file
diff --git a/src/inputs/combodate/lib/moment.min.js b/src/inputs/combodate/lib/moment.min.js
new file mode 100644
index 0000000..67cb152
--- /dev/null
+++ b/src/inputs/combodate/lib/moment.min.js
@@ -0,0 +1,6 @@
+// moment.js
+// version : 1.7.2
+// author : Tim Wood
+// license : MIT
+// momentjs.com
+(function(a){function E(a,b,c,d){var e=c.lang();return e[a].call?e[a](c,d):e[a][b]}function F(a,b){return function(c){return K(a.call(this,c),b)}}function G(a){return function(b){var c=a.call(this,b);return c+this.lang().ordinal(c)}}function H(a,b,c){this._d=a,this._isUTC=!!b,this._a=a._a||null,this._lang=c||!1}function I(a){var b=this._data={},c=a.years||a.y||0,d=a.months||a.M||0,e=a.weeks||a.w||0,f=a.days||a.d||0,g=a.hours||a.h||0,h=a.minutes||a.m||0,i=a.seconds||a.s||0,j=a.milliseconds||a.ms||0;this._milliseconds=j+i*1e3+h*6e4+g*36e5,this._days=f+e*7,this._months=d+c*12,b.milliseconds=j%1e3,i+=J(j/1e3),b.seconds=i%60,h+=J(i/60),b.minutes=h%60,g+=J(h/60),b.hours=g%24,f+=J(g/24),f+=e*7,b.days=f%30,d+=J(f/30),b.months=d%12,c+=J(d/12),b.years=c,this._lang=!1}function J(a){return a<0?Math.ceil(a):Math.floor(a)}function K(a,b){var c=a+"";while(c.length<b)c="0"+c;return c}function L(a,b,c){var d=b._milliseconds,e=b._days,f=b._months,g;d&&a._d.setTime(+a+d*c),e&&a.date(a.date()+e*c),f&&(g=a.date(),a.date(1).month(a.month()+f*c).date(Math.min(g,a.daysInMonth())))}function M(a){return Object.prototype.toString.call(a)==="[object Array]"}function N(a,b){var c=Math.min(a.length,b.length),d=Math.abs(a.length-b.length),e=0,f;for(f=0;f<c;f++)~~a[f]!==~~b[f]&&e++;return e+d}function O(a,b,c,d){var e,f,g=[];for(e=0;e<7;e++)g[e]=a[e]=a[e]==null?e===2?1:0:a[e];return a[7]=g[7]=b,a[8]!=null&&(g[8]=a[8]),a[3]+=c||0,a[4]+=d||0,f=new Date(0),b?(f.setUTCFullYear(a[0],a[1],a[2]),f.setUTCHours(a[3],a[4],a[5],a[6])):(f.setFullYear(a[0],a[1],a[2]),f.setHours(a[3],a[4],a[5],a[6])),f._a=g,f}function P(a,c){var d,e,g=[];!c&&h&&(c=require("./lang/"+a));for(d=0;d<i.length;d++)c[i[d]]=c[i[d]]||f.en[i[d]];for(d=0;d<12;d++)e=b([2e3,d]),g[d]=new RegExp("^"+(c.months[d]||c.months(e,""))+"|^"+(c.monthsShort[d]||c.monthsShort(e,"")).replace(".",""),"i");return c.monthsParse=c.monthsParse||g,f[a]=c,c}function Q(a){var c=typeof a=="string"&&a||a&&a._lang||null;return c?f[c]||P(c):b}function R(a){return a.match(/\[.*\]/)?a.replace(/^\[|\]$/g,""):a.replace(/\\/g,"")}function S(a){var b=a.match(k),c,d;for(c=0,d=b.length;c<d;c++)D[b[c]]?b[c]=D[b[c]]:b[c]=R(b[c]);return function(e){var f="";for(c=0;c<d;c++)f+=typeof b[c].call=="function"?b[c].call(e,a):b[c];return f}}function T(a,b){function d(b){return a.lang().longDateFormat[b]||b}var c=5;while(c--&&l.test(b))b=b.replace(l,d);return A[b]||(A[b]=S(b)),A[b](a)}function U(a){switch(a){case"DDDD":return p;case"YYYY":return q;case"S":case"SS":case"SSS":case"DDD":return o;case"MMM":case"MMMM":case"dd":case"ddd":case"dddd":case"a":case"A":return r;case"Z":case"ZZ":return s;case"T":return t;case"MM":case"DD":case"YY":case"HH":case"hh":case"mm":case"ss":case"M":case"D":case"d":case"H":case"h":case"m":case"s":return n;default:return new RegExp(a.replace("\\",""))}}function V(a,b,c,d){var e,f;switch(a){case"M":case"MM":c[1]=b==null?0:~~b-1;break;case"MMM":case"MMMM":for(e=0;e<12;e++)if(Q().monthsParse[e].test(b)){c[1]=e,f=!0;break}f||(c[8]=!1);break;case"D":case"DD":case"DDD":case"DDDD":b!=null&&(c[2]=~~b);break;case"YY":c[0]=~~b+(~~b>70?1900:2e3);break;case"YYYY":c[0]=~~Math.abs(b);break;case"a":case"A":d.isPm=(b+"").toLowerCase()==="pm";break;case"H":case"HH":case"h":case"hh":c[3]=~~b;break;case"m":case"mm":c[4]=~~b;break;case"s":case"ss":c[5]=~~b;break;case"S":case"SS":case"SSS":c[6]=~~(("0."+b)*1e3);break;case"Z":case"ZZ":d.isUTC=!0,e=(b+"").match(x),e&&e[1]&&(d.tzh=~~e[1]),e&&e[2]&&(d.tzm=~~e[2]),e&&e[0]==="+"&&(d.tzh=-d.tzh,d.tzm=-d.tzm)}b==null&&(c[8]=!1)}function W(a,b){var c=[0,0,1,0,0,0,0],d={tzh:0,tzm:0},e=b.match(k),f,g;for(f=0;f<e.length;f++)g=(U(e[f]).exec(a)||[])[0],g&&(a=a.slice(a.indexOf(g)+g.length)),D[e[f]]&&V(e[f],g,c,d);return d.isPm&&c[3]<12&&(c[3]+=12),d.isPm===!1&&c[3]===12&&(c[3]=0),O(c,d.isUTC,d.tzh,d.tzm)}function X(a,b){var c,d=a.match(m)||[],e,f=99,g,h,i;for(g=0;g<b.length;g++)h=W(a,b[g]),e=T(new H(h),b[g]).match(m)||[],i=N(d,e),i<f&&(f=i,c=h);return c}function Y(a){var b="YYYY-MM-DDT",c;if(u.exec(a)){for(c=0;c<4;c++)if(w[c][1].exec(a)){b+=w[c][0];break}return s.exec(a)?W(a,b+" Z"):W(a,b)}return new Date(a)}function Z(a,b,c,d,e){var f=e.relativeTime[a];return typeof f=="function"?f(b||1,!!c,a,d):f.replace(/%d/i,b||1)}function $(a,b,c){var e=d(Math.abs(a)/1e3),f=d(e/60),g=d(f/60),h=d(g/24),i=d(h/365),j=e<45&&["s",e]||f===1&&["m"]||f<45&&["mm",f]||g===1&&["h"]||g<22&&["hh",g]||h===1&&["d"]||h<=25&&["dd",h]||h<=45&&["M"]||h<345&&["MM",d(h/30)]||i===1&&["y"]||["yy",i];return j[2]=b,j[3]=a>0,j[4]=c,Z.apply({},j)}function _(a,c){b.fn[a]=function(a){var b=this._isUTC?"UTC":"";return a!=null?(this._d["set"+b+c](a),this):this._d["get"+b+c]()}}function ab(a){b.duration.fn[a]=function(){return this._data[a]}}function bb(a,c){b.duration.fn["as"+a]=function(){return+this/c}}var b,c="1.7.2",d=Math.round,e,f={},g="en",h=typeof module!="undefined"&&module.exports,i="months|monthsShort|weekdays|weekdaysShort|weekdaysMin|longDateFormat|calendar|relativeTime|ordinal|meridiem".split("|"),j=/^\/?Date\((\-?\d+)/i,k=/(\[[^\[]*\])|(\\)?(Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|YYYY|YY|a|A|hh?|HH?|mm?|ss?|SS?S?|zz?|ZZ?|.)/g,l=/(\[[^\[]*\])|(\\)?(LT|LL?L?L?)/g,m=/([0-9a-zA-Z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+)/gi,n=/\d\d?/,o=/\d{1,3}/,p=/\d{3}/,q=/\d{1,4}/,r=/[0-9a-z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+/i,s=/Z|[\+\-]\d\d:?\d\d/i,t=/T/i,u=/^\s*\d{4}-\d\d-\d\d(T(\d\d(:\d\d(:\d\d(\.\d\d?\d?)?)?)?)?([\+\-]\d\d:?\d\d)?)?/,v="YYYY-MM-DDTHH:mm:ssZ",w=[["HH:mm:ss.S",/T\d\d:\d\d:\d\d\.\d{1,3}/],["HH:mm:ss",/T\d\d:\d\d:\d\d/],["HH:mm",/T\d\d:\d\d/],["HH",/T\d\d/]],x=/([\+\-]|\d\d)/gi,y="Month|Date|Hours|Minutes|Seconds|Milliseconds".split("|"),z={Milliseconds:1,Seconds:1e3,Minutes:6e4,Hours:36e5,Days:864e5,Months:2592e6,Years:31536e6},A={},B="DDD w M D d".split(" "),C="M D H h m s w".split(" "),D={M:function(){return this.month()+1},MMM:function(a){return E("monthsShort",this.month(),this,a)},MMMM:function(a){return E("months",this.month(),this,a)},D:function(){return this.date()},DDD:function(){var a=new Date(this.year(),this.month(),this.date()),b=new Date(this.year(),0,1);return~~((a-b)/864e5+1.5)},d:function(){return this.day()},dd:function(a){return E("weekdaysMin",this.day(),this,a)},ddd:function(a){return E("weekdaysShort",this.day(),this,a)},dddd:function(a){return E("weekdays",this.day(),this,a)},w:function(){var a=new Date(this.year(),this.month(),this.date()-this.day()+5),b=new Date(a.getFullYear(),0,4);return~~((a-b)/864e5/7+1.5)},YY:function(){return K(this.year()%100,2)},YYYY:function(){return K(this.year(),4)},a:function(){return this.lang().meridiem(this.hours(),this.minutes(),!0)},A:function(){return this.lang().meridiem(this.hours(),this.minutes(),!1)},H:function(){return this.hours()},h:function(){return this.hours()%12||12},m:function(){return this.minutes()},s:function(){return this.seconds()},S:function(){return~~(this.milliseconds()/100)},SS:function(){return K(~~(this.milliseconds()/10),2)},SSS:function(){return K(this.milliseconds(),3)},Z:function(){var a=-this.zone(),b="+";return a<0&&(a=-a,b="-"),b+K(~~(a/60),2)+":"+K(~~a%60,2)},ZZ:function(){var a=-this.zone(),b="+";return a<0&&(a=-a,b="-"),b+K(~~(10*a/6),4)}};while(B.length)e=B.pop(),D[e+"o"]=G(D[e]);while(C.length)e=C.pop(),D[e+e]=F(D[e],2);D.DDDD=F(D.DDD,3),b=function(c,d){if(c===null||c==="")return null;var e,f;return b.isMoment(c)?new H(new Date(+c._d),c._isUTC,c._lang):(d?M(d)?e=X(c,d):e=W(c,d):(f=j.exec(c),e=c===a?new Date:f?new Date(+f[1]):c instanceof Date?c:M(c)?O(c):typeof c=="string"?Y(c):new Date(c)),new H(e))},b.utc=function(a,c){return M(a)?new H(O(a,!0),!0):(typeof a=="string"&&!s.exec(a)&&(a+=" +0000",c&&(c+=" Z")),b(a,c).utc())},b.unix=function(a){return b(a*1e3)},b.duration=function(a,c){var d=b.isDuration(a),e=typeof a=="number",f=d?a._data:e?{}:a,g;return e&&(c?f[c]=a:f.milliseconds=a),g=new I(f),d&&(g._lang=a._lang),g},b.humanizeDuration=function(a,c,d){return b.duration(a,c===!0?null:c).humanize(c===!0?!0:d)},b.version=c,b.defaultFormat=v,b.lang=function(a,c){var d;if(!a)return g;(c||!f[a])&&P(a,c);if(f[a]){for(d=0;d<i.length;d++)b[i[d]]=f[a][i[d]];b.monthsParse=f[a].monthsParse,g=a}},b.langData=Q,b.isMoment=function(a){return a instanceof H},b.isDuration=function(a){return a instanceof I},b.lang("en",{months:"January_February_March_April_May_June_July_August_September_October_November_December".split("_"),monthsShort:"Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"),weekdays:"Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),weekdaysShort:"Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"),weekdaysMin:"Su_Mo_Tu_We_Th_Fr_Sa".split("_"),longDateFormat:{LT:"h:mm A",L:"MM/DD/YYYY",LL:"MMMM D YYYY",LLL:"MMMM D YYYY LT",LLLL:"dddd, MMMM D YYYY LT"},meridiem:function(a,b,c){return a>11?c?"pm":"PM":c?"am":"AM"},calendar:{sameDay:"[Today at] LT",nextDay:"[Tomorrow at] LT",nextWeek:"dddd [at] LT",lastDay:"[Yesterday at] LT",lastWeek:"[last] dddd [at] LT",sameElse:"L"},relativeTime:{future:"in %s",past:"%s ago",s:"a few seconds",m:"a minute",mm:"%d minutes",h:"an hour",hh:"%d hours",d:"a day",dd:"%d days",M:"a month",MM:"%d months",y:"a year",yy:"%d years"},ordinal:function(a){var b=a%10;return~~(a%100/10)===1?"th":b===1?"st":b===2?"nd":b===3?"rd":"th"}}),b.fn=H.prototype={clone:function(){return b(this)},valueOf:function(){return+this._d},unix:function(){return Math.floor(+this._d/1e3)},toString:function(){return this._d.toString()},toDate:function(){return this._d},toArray:function(){var a=this;return[a.year(),a.month(),a.date(),a.hours(),a.minutes(),a.seconds(),a.milliseconds(),!!this._isUTC]},isValid:function(){return this._a?this._a[8]!=null?!!this._a[8]:!N(this._a,(this._a[7]?b.utc(this._a):b(this._a)).toArray()):!isNaN(this._d.getTime())},utc:function(){return this._isUTC=!0,this},local:function(){return this._isUTC=!1,this},format:function(a){return T(this,a?a:b.defaultFormat)},add:function(a,c){var d=c?b.duration(+c,a):b.duration(a);return L(this,d,1),this},subtract:function(a,c){var d=c?b.duration(+c,a):b.duration(a);return L(this,d,-1),this},diff:function(a,c,e){var f=this._isUTC?b(a).utc():b(a).local(),g=(this.zone()-f.zone())*6e4,h=this._d-f._d-g,i=this.year()-f.year(),j=this.month()-f.month(),k=this.date()-f.date(),l;return c==="months"?l=i*12+j+k/30:c==="years"?l=i+(j+k/30)/12:l=c==="seconds"?h/1e3:c==="minutes"?h/6e4:c==="hours"?h/36e5:c==="days"?h/864e5:c==="weeks"?h/6048e5:h,e?l:d(l)},from:function(a,c){return b.duration(this.diff(a)).lang(this._lang).humanize(!c)},fromNow:function(a){return this.from(b(),a)},calendar:function(){var a=this.diff(b().sod(),"days",!0),c=this.lang().calendar,d=c.sameElse,e=a<-6?d:a<-1?c.lastWeek:a<0?c.lastDay:a<1?c.sameDay:a<2?c.nextDay:a<7?c.nextWeek:d;return this.format(typeof e=="function"?e.apply(this):e)},isLeapYear:function(){var a=this.year();return a%4===0&&a%100!==0||a%400===0},isDST:function(){return this.zone()<b([this.year()]).zone()||this.zone()<b([this.year(),5]).zone()},day:function(a){var b=this._isUTC?this._d.getUTCDay():this._d.getDay();return a==null?b:this.add({d:a-b})},startOf:function(a){switch(a.replace(/s$/,"")){case"year":this.month(0);case"month":this.date(1);case"day":this.hours(0);case"hour":this.minutes(0);case"minute":this.seconds(0);case"second":this.milliseconds(0)}return this},endOf:function(a){return this.startOf(a).add(a.replace(/s?$/,"s"),1).subtract("ms",1)},sod:function(){return this.clone().startOf("day")},eod:function(){return this.clone().endOf("day")},zone:function(){return this._isUTC?0:this._d.getTimezoneOffset()},daysInMonth:function(){return b.utc([this.year(),this.month()+1,0]).date()},lang:function(b){return b===a?Q(this):(this._lang=b,this)}};for(e=0;e<y.length;e++)_(y[e].toLowerCase(),y[e]);_("year","FullYear"),b.duration.fn=I.prototype={weeks:function(){return J(this.days()/7)},valueOf:function(){return this._milliseconds+this._days*864e5+this._months*2592e6},humanize:function(a){var b=+this,c=this.lang().relativeTime,d=$(b,!a,this.lang()),e=b<=0?c.past:c.future;return a&&(typeof e=="function"?d=e(d):d=e.replace(/%s/i,d)),d},lang:b.fn.lang};for(e in z)z.hasOwnProperty(e)&&(bb(e,z[e]),ab(e.toLowerCase()));bb("Weeks",6048e5),h&&(module.exports=b),typeof ender=="undefined"&&(this.moment=b),typeof define=="function"&&define.amd&&define("moment",[],function(){return b})}).call(this);
\ No newline at end of file
diff --git a/test/loader.js b/test/loader.js
index 5fa9de7..291c881 100644
--- a/test/loader.js
+++ b/test/loader.js
@@ -31,6 +31,7 @@ define(function () {
                         loadCss(require.toUrl("./editable-element.css")); 
                     }                         
                 },
+                //default inputs
                 'editable-form/editable-form': {
                     deps: ['require',
                     'inputs/text',
@@ -38,6 +39,7 @@ define(function () {
                     'inputs/select',
                     'inputs/checklist',
                     'inputs/html5types',
+                    'inputs/combodate/combodate',
                     'inputs-ext/address/address'],
                     init: function(require) {
                         loadCss(require.toUrl("./editable-form.css")); 
@@ -49,7 +51,8 @@ define(function () {
                 'inputs/text': ['inputs/abstract'],
                 'inputs/textarea': ['inputs/abstract'],
                 'inputs/abstract': ['editable-form/editable-form-utils'],   
-                'inputs/html5types': ['inputs/text'],   
+                'inputs/html5types': ['inputs/text'], 
+                'inputs/combodate/combodate': ['inputs/abstract', 'inputs/combodate/lib/combodate', 'inputs/combodate/lib/moment.min'],  
 
                 /*
                  bootstrap
diff --git a/test/main.js b/test/main.js
index ee32ab3..0863c1c 100644
--- a/test/main.js
+++ b/test/main.js
@@ -44,7 +44,8 @@ require(["loader", jqurl], function(loader) {
             'test/unit/text',
             'test/unit/textarea',
             'test/unit/select',
-            'test/unit/checklist'
+            'test/unit/checklist',
+            'test/unit/combodate'
        ];
        tests = tests.concat(custom);
        tests.push('test/unit/api');
diff --git a/test/unit/combodate.js b/test/unit/combodate.js
new file mode 100644
index 0000000..7e0f275
--- /dev/null
+++ b/test/unit/combodate.js
@@ -0,0 +1,107 @@
+$(function () {         
+   
+   //formats
+   var 
+     fd = 'DD.MM.YYYY', vfd = 'DD-MM-YYYY', vd = '15-05-1984',
+     fdt = 'DD-MM-YYYY hh:mm:ss A', vfdt = 'DD MMM YYYY h:m:s a', vdt = '15-05-1984 08:20:30 PM';
+
+   
+   module("combodate", {
+        setup: function(){
+            fx = $('#async-fixture');
+            $.support.transition = false;
+        }        
+    });
+    
+    asyncTest("container should contain combodate and save new value (date)", function () {
+        
+        var  e = $('<a href="#" data-type="combodate" data-pk="1" data-url="/combodate">'+vd+'</a>').appendTo(fx).editable({
+                format: fd,
+                viewformat: vfd,
+                template: fd
+            }),
+            m = moment(vd, vfd);
+        
+          $.mockjax({
+              url: '/combodate',
+              response: function(settings) {
+                  equal(settings.data.value, m.format(fd), 'submitted value correct');            
+              }
+          });
+       
+        equal(e.data('editable').value.format(fd), m.format(fd), 'init value correct');
+            
+        e.click();
+        var p = tip(e);
+        ok(p.find('.combodate').is(':visible'), 'combodate exists');
+        equal(p.find('.day, .month, .year, .hour, .minute').length, 3, 'combos correct');        
+        
+        equal(p.find('.day').val(), m.date(), 'day set correct');
+        equal(p.find('.month').val(), m.month(), 'month set correct');
+        equal(p.find('.year').val(), m.year(), 'year set correct');
+
+        //set new day
+        p.find('.day').val(16).trigger('change');
+        m.date(16);
+        p.find('form').submit();
+    
+        setTimeout(function() {          
+           ok(!p.is(':visible'), 'container closed');
+           equal(e.data('editable').value.format(fd), m.format(fd), 'new value correct');
+           equal(e.text(), m.format(vfd), 'new text correct');            
+           e.remove();    
+           start();  
+        }, timeout); 
+        
+     });  
+     
+    asyncTest("container should contain combodate and save new value (datetime)", function () {
+        
+        var  e = $('<a href="#" data-type="combodate" data-pk="1" data-url="/combodate-dt" data-value="'+vdt+'"></a>').appendTo(fx).editable({
+                format: fdt,
+                viewformat: vfdt,
+                template: fdt
+            }),
+            m = moment(vdt, fdt);
+
+          $.mockjax({
+              url: '/combodate-dt',
+              response: function(settings) {
+                  equal(settings.data.value, m.format(fdt), 'submitted value correct');            
+              }
+          });
+       
+        equal(e.data('editable').value.format(fdt), m.format(fdt), 'init value correct');
+        equal(e.text(), m.format(vfdt), 'init text correct');            
+            
+        e.click();
+        var p = tip(e);
+        ok(p.find('.combodate').is(':visible'), 'combodate exists');
+        equal(p.find('.day, .month, .year, .hour, .minute, .second, .ampm').length, 7, 'combos correct');        
+        
+        equal(p.find('.day').val(), m.date(), 'day set correct');
+        equal(p.find('.month').val(), m.month(), 'month set correct');
+        equal(p.find('.year').val(), m.year(), 'year set correct');
+        equal(p.find('.hour').val(), m.hours()-12, 'hour set correct');
+        equal(p.find('.minute').val(), m.minutes(), 'minute set correct');
+        equal(p.find('.second').val(), m.seconds(), 'second set correct');
+        equal(p.find('.ampm').val(), 'pm', 'ampm set correct');
+
+        //set new day
+        p.find('.day').val(16).trigger('change');
+        p.find('.hour').val(9).trigger('change');
+        m.date(16);
+        m.hours(21);
+        p.find('form').submit();
+    
+        setTimeout(function() {          
+           ok(!p.is(':visible'), 'container closed');
+           equal(e.data('editable').value.format(fdt), m.format(fdt), 'new value correct');
+           equal(e.text(), m.format(vfdt), 'new text correct');            
+           e.remove();    
+           start();  
+        }, timeout); 
+        
+     });       
+
+});
\ No newline at end of file